C23H30N8 — CID 133279610
1-[[1-[1-(4-methylphenyl)tetrazol-5-yl]piperidin-3-yl]methyl]-4-pyridin-2-ylpiperazine (PubChem CID 133279610) has the molecular formula C23H30N8 and a molecular weight of 418.55 g/mol. Its IUPAC name is 1-[[1-[1-(4-methylphenyl)tetrazol-5-yl]piperidin-3-yl]methyl]-4-pyridin-2-ylpiperazine.
| Compound Name | 1-[[1-[1-(4-methylphenyl)tetrazol-5-yl]piperidin-3-yl]methyl]-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 133279610 |
| Molecular Formula | C23H30N8 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 1-[[1-[1-(4-methylphenyl)tetrazol-5-yl]piperidin-3-yl]methyl]-4-pyridin-2-ylpiperazine |
| SMILES | Cc1ccc(-n2nnnc2N2CCCC(CN3CCN(c4ccccn4)CC3)C2)cc1 |
| InChI | InChI=1S/C23H30N8/c1-19-7-9-21(10-8-19)31-23(25-26-27-31)30-12-4-5-20(18-30)17-28-13-15-29(16-14-28)22-6-2-3-11-24-22/h2-3,6-11,20H,4-5,12-18H2,1H3 |
| InChIKey | YHCWFHQSSQEPGA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |