C20H26N6 — CID 126893632
2-cyclobutyl-4-[3-(4-pyridin-2-ylpiperazin-1-yl)azetidin-1-yl]pyrimidine (PubChem CID 126893632) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-cyclobutyl-4-[3-(4-pyridin-2-ylpiperazin-1-yl)azetidin-1-yl]pyrimidine.
| Compound Name | 2-cyclobutyl-4-[3-(4-pyridin-2-ylpiperazin-1-yl)azetidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 126893632 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 2-cyclobutyl-4-[3-(4-pyridin-2-ylpiperazin-1-yl)azetidin-1-yl]pyrimidine |
| SMILES | c1ccc(N2CCN(C3CN(c4ccnc(C5CCC5)n4)C3)CC2)nc1 |
| InChI | InChI=1S/C20H26N6/c1-2-8-21-18(6-1)25-12-10-24(11-13-25)17-14-26(15-17)19-7-9-22-20(23-19)16-4-3-5-16/h1-2,6-9,16-17H,3-5,10-15H2 |
| InChIKey | FKDPMOBCTGBMFH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |