C18H28N4 — CID 126893395
1-(1-cyclohexylazetidin-3-yl)-4-pyridin-2-ylpiperazine (PubChem CID 126893395) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-(1-cyclohexylazetidin-3-yl)-4-pyridin-2-ylpiperazine.
| Compound Name | 1-(1-cyclohexylazetidin-3-yl)-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 126893395 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-(1-cyclohexylazetidin-3-yl)-4-pyridin-2-ylpiperazine |
| SMILES | c1ccc(N2CCN(C3CN(C4CCCCC4)C3)CC2)nc1 |
| InChI | InChI=1S/C18H28N4/c1-2-6-16(7-3-1)22-14-17(15-22)20-10-12-21(13-11-20)18-8-4-5-9-19-18/h4-5,8-9,16-17H,1-3,6-7,10-15H2 |
| InChIKey | PDEMCSRLWKVIEA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |