C17H25N3O2 — CID 10979611
1-(1,4-dioxaspiro[4.5]decan-8-yl)-4-pyridin-2-ylpiperazine (PubChem CID 10979611) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-4-pyridin-2-ylpiperazine.
| Compound Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 10979611 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-4-pyridin-2-ylpiperazine |
| SMILES | c1ccc(N2CCN(C3CCC4(CC3)OCCO4)CC2)nc1 |
| InChI | InChI=1S/C17H25N3O2/c1-2-8-18-16(3-1)20-11-9-19(10-12-20)15-4-6-17(7-5-15)21-13-14-22-17/h1-3,8,15H,4-7,9-14H2 |
| InChIKey | WDEHSFXXIIPABU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |