C15H26N2O2 — CID 131872684
1-cyclopropyl-4-(1,4-dioxaspiro[4.5]decan-8-yl)piperazine (PubChem CID 131872684) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-cyclopropyl-4-(1,4-dioxaspiro[4.5]decan-8-yl)piperazine.
| Compound Name | 1-cyclopropyl-4-(1,4-dioxaspiro[4.5]decan-8-yl)piperazine |
|---|---|
| PubChem CID | 131872684 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1-cyclopropyl-4-(1,4-dioxaspiro[4.5]decan-8-yl)piperazine |
| SMILES | C1COC2(CCC(N3CCN(C4CC4)CC3)CC2)O1 |
| InChI | InChI=1S/C15H26N2O2/c1-2-13(1)16-7-9-17(10-8-16)14-3-5-15(6-4-14)18-11-12-19-15/h13-14H,1-12H2 |
| InChIKey | IXJOENBGIWYPMR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |