C15H26N2O3 — CID 79931334
7-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 79931334) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 7-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol.
| Compound Name | 7-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 79931334 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 7-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | OC1CCC2(CC1N1CCN3CCCC3C1)OCCO2 |
| InChI | InChI=1S/C15H26N2O3/c18-14-3-4-15(19-8-9-20-15)10-13(14)17-7-6-16-5-1-2-12(16)11-17/h12-14,18H,1-11H2 |
| InChIKey | LHWTWYGCTHXVLX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |