About trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol
trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol (PubChem CID 126846526) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol |
| PubChem CID | 126846526 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@H]1N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H21NO3/c14-11-3-1-2-10(11)13-6-4-12(5-7-13)15-8-9-16-12/h10-11,14H,1-9H2/t10-,11-/m1/s1 |
| InChIKey | PBCRTEJIYVXVHQ-GHMZBOCLSA-N |
| XLogP | 0.74 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol?
The IUPAC name of trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol (CID 126846526) is trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol.
What is the SMILES notation for trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol?
The canonical SMILES for trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol is O[C@@H]1CCC[C@H]1N1CCC2(CC1)OCCO2.
What is the InChIKey of trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol?
The InChIKey is PBCRTEJIYVXVHQ-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H21NO3/c14-11-3-1-2-10(11)13-6-4-12(5-7-13)15-8-9-16-12/h10-11,14H,1-9H2/t10-,11-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol?
trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol has a molecular weight of 227.30 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)cyclopentan-1-ol is sourced from PubChem (CID 126846526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).