C10H19NO — CID 23656399
cis-(1S,2R)-2-pyrrolidin-1-ylcyclohexan-1-ol (PubChem CID 23656399) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is cis-(1S,2R)-2-pyrrolidin-1-ylcyclohexan-1-ol.
| Compound Name | cis-(1S,2R)-2-pyrrolidin-1-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 23656399 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | cis-(1S,2R)-2-pyrrolidin-1-ylcyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C10H19NO/c12-10-6-2-1-5-9(10)11-7-3-4-8-11/h9-10,12H,1-8H2/t9-,10+/m1/s1 |
| InChIKey | QPIDLIAAUJBCSD-ZJUUUORDSA-N |
| XLogP | 1.39 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |