C12H21NO3 — CID 103738480
8-(oxan-3-yl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 103738480) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 8-(oxan-3-yl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(oxan-3-yl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 103738480 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 8-(oxan-3-yl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | C1COCC(N2CCC3(CC2)OCCO3)C1 |
| InChI | InChI=1S/C12H21NO3/c1-2-11(10-14-7-1)13-5-3-12(4-6-13)15-8-9-16-12/h11H,1-10H2 |
| InChIKey | XLKYESXTXGWEHV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |