C22H42N2O2 — CID 141070274
(12R,23R)-14,21-dioxa-1,8-diazatricyclo[21.3.0.08,12]hexacosane (PubChem CID 141070274) has the molecular formula C22H42N2O2 and a molecular weight of 366.59 g/mol. Its IUPAC name is (12R,23R)-14,21-dioxa-1,8-diazatricyclo[21.3.0.08,12]hexacosane.
| Compound Name | (12R,23R)-14,21-dioxa-1,8-diazatricyclo[21.3.0.08,12]hexacosane |
|---|---|
| PubChem CID | 141070274 |
| Molecular Formula | C22H42N2O2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.32 |
| IUPAC Name | (12R,23R)-14,21-dioxa-1,8-diazatricyclo[21.3.0.08,12]hexacosane |
| SMILES | C1CCCOC[C@H]2CCCN2CCCCCCN2CCC[C@@H]2COCC1 |
| InChI | InChI=1S/C22H42N2O2/c1-2-6-14-24-16-10-12-22(24)20-26-18-8-4-3-7-17-25-19-21-11-9-15-23(21)13-5-1/h21-22H,1-20H2/t21-,22-/m1/s1 |
| InChIKey | GKKMFKBGHDGOPI-FGZHOGPDSA-N |
| XLogP | 4.08 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |