About 1-cyclohexylazocane
1-cyclohexylazocane (PubChem CID 23151203) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 1-cyclohexylazocane.
Molecular Properties
| Compound Name | 1-cyclohexylazocane |
| PubChem CID | 23151203 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1-cyclohexylazocane |
| SMILES | C1CCCN(C2CCCCC2)CCC1 |
| InChI | InChI=1S/C13H25N/c1-2-7-11-14(12-8-3-1)13-9-5-4-6-10-13/h13H,1-12H2 |
| InChIKey | ZEECIIUZJOUOSE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexylazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylazocane?
The IUPAC name of 1-cyclohexylazocane (CID 23151203) is 1-cyclohexylazocane.
What is the SMILES notation for 1-cyclohexylazocane?
The canonical SMILES for 1-cyclohexylazocane is C1CCCN(C2CCCCC2)CCC1.
What is the InChIKey of 1-cyclohexylazocane?
The InChIKey is ZEECIIUZJOUOSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-2-7-11-14(12-8-3-1)13-9-5-4-6-10-13/h13H,1-12H2.
What are the key properties of 1-cyclohexylazocane?
1-cyclohexylazocane has a molecular weight of 195.35 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylazocane is sourced from PubChem (CID 23151203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).