About 1-cyclooctylpyrrolidine
1-cyclooctylpyrrolidine (PubChem CID 23277874) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 1-cyclooctylpyrrolidine.
Molecular Properties
| Compound Name | 1-cyclooctylpyrrolidine |
| PubChem CID | 23277874 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1-cyclooctylpyrrolidine |
| SMILES | C1CCCC(N2CCCC2)CCC1 |
| InChI | InChI=1S/C12H23N/c1-2-4-8-12(9-5-3-1)13-10-6-7-11-13/h12H,1-11H2 |
| InChIKey | BSSACIAVNSQTOE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclooctylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclooctylpyrrolidine?
The IUPAC name of 1-cyclooctylpyrrolidine (CID 23277874) is 1-cyclooctylpyrrolidine.
What is the SMILES notation for 1-cyclooctylpyrrolidine?
The canonical SMILES for 1-cyclooctylpyrrolidine is C1CCCC(N2CCCC2)CCC1.
What is the InChIKey of 1-cyclooctylpyrrolidine?
The InChIKey is BSSACIAVNSQTOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-2-4-8-12(9-5-3-1)13-10-6-7-11-13/h12H,1-11H2.
What are the key properties of 1-cyclooctylpyrrolidine?
1-cyclooctylpyrrolidine has a molecular weight of 181.32 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclooctylpyrrolidine is sourced from PubChem (CID 23277874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).