About CID 175727151
CID 175727151 (PubChem CID 175727151) has the molecular formula C7H13NNa2
and a molecular weight of 157.17 g/mol.
Molecular Properties
| Compound Name | CID 175727151 |
| PubChem CID | 175727151 |
| Molecular Formula | C7H13NNa2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.08 |
| IUPAC Name | — |
| SMILES | C1CC2CCCN2C1.[Na].[Na] |
| InChI | InChI=1S/C7H13N.2Na/c1-3-7-4-2-6-8(7)5-1;;/h7H,1-6H2;; |
| InChIKey | RZZBGNJHJSPSJP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 175727151 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175727151?
The IUPAC name of CID 175727151 (CID 175727151) is not available.
What is the SMILES notation for CID 175727151?
The canonical SMILES for CID 175727151 is C1CC2CCCN2C1.[Na].[Na].
What is the InChIKey of CID 175727151?
The InChIKey is RZZBGNJHJSPSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.2Na/c1-3-7-4-2-6-8(7)5-1;;/h7H,1-6H2;;.
What are the key properties of CID 175727151?
CID 175727151 has a molecular weight of 157.17 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175727151 is sourced from PubChem (CID 175727151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).