About 5-cyclopentyl-1,5-oxazocane
5-cyclopentyl-1,5-oxazocane (PubChem CID 174168377) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 5-cyclopentyl-1,5-oxazocane.
Molecular Properties
| Compound Name | 5-cyclopentyl-1,5-oxazocane |
| PubChem CID | 174168377 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 5-cyclopentyl-1,5-oxazocane |
| SMILES | C1CCC(N2CCCOCCC2)C1 |
| InChI | InChI=1S/C11H21NO/c1-2-6-11(5-1)12-7-3-9-13-10-4-8-12/h11H,1-10H2 |
| InChIKey | YWNUPESRLMUQPS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclopentyl-1,5-oxazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-1,5-oxazocane?
The IUPAC name of 5-cyclopentyl-1,5-oxazocane (CID 174168377) is 5-cyclopentyl-1,5-oxazocane.
What is the SMILES notation for 5-cyclopentyl-1,5-oxazocane?
The canonical SMILES for 5-cyclopentyl-1,5-oxazocane is C1CCC(N2CCCOCCC2)C1.
What is the InChIKey of 5-cyclopentyl-1,5-oxazocane?
The InChIKey is YWNUPESRLMUQPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-2-6-11(5-1)12-7-3-9-13-10-4-8-12/h11H,1-10H2.
What are the key properties of 5-cyclopentyl-1,5-oxazocane?
5-cyclopentyl-1,5-oxazocane has a molecular weight of 183.29 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-1,5-oxazocane is sourced from PubChem (CID 174168377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).