About 1-cyclooctylpiperidine
1-cyclooctylpiperidine (PubChem CID 89210756) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 1-cyclooctylpiperidine.
Molecular Properties
| Compound Name | 1-cyclooctylpiperidine |
| PubChem CID | 89210756 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1-cyclooctylpiperidine |
| SMILES | C1CCCC(N2CCCCC2)CCC1 |
| InChI | InChI=1S/C13H25N/c1-2-5-9-13(10-6-3-1)14-11-7-4-8-12-14/h13H,1-12H2 |
| InChIKey | ZQPFLIROOPFTKS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclooctylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclooctylpiperidine?
The IUPAC name of 1-cyclooctylpiperidine (CID 89210756) is 1-cyclooctylpiperidine.
What is the SMILES notation for 1-cyclooctylpiperidine?
The canonical SMILES for 1-cyclooctylpiperidine is C1CCCC(N2CCCCC2)CCC1.
What is the InChIKey of 1-cyclooctylpiperidine?
The InChIKey is ZQPFLIROOPFTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-2-5-9-13(10-6-3-1)14-11-7-4-8-12-14/h13H,1-12H2.
What are the key properties of 1-cyclooctylpiperidine?
1-cyclooctylpiperidine has a molecular weight of 195.35 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclooctylpiperidine is sourced from PubChem (CID 89210756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).