About 1-cyclohexylazetidine;2-methylpropane
1-cyclohexylazetidine;2-methylpropane (PubChem CID 178017193) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 1-cyclohexylazetidine;2-methylpropane.
Molecular Properties
| Compound Name | 1-cyclohexylazetidine;2-methylpropane |
| PubChem CID | 178017193 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 1-cyclohexylazetidine;2-methylpropane |
| SMILES | C1CCC(N2CCC2)CC1.CC(C)C |
| InChI | InChI=1S/C9H17N.C4H10/c1-2-5-9(6-3-1)10-7-4-8-10;1-4(2)3/h9H,1-8H2;4H,1-3H3 |
| InChIKey | PMRSKHKCOIGDQN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexylazetidine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylazetidine;2-methylpropane?
The IUPAC name of 1-cyclohexylazetidine;2-methylpropane (CID 178017193) is 1-cyclohexylazetidine;2-methylpropane.
What is the SMILES notation for 1-cyclohexylazetidine;2-methylpropane?
The canonical SMILES for 1-cyclohexylazetidine;2-methylpropane is C1CCC(N2CCC2)CC1.CC(C)C.
What is the InChIKey of 1-cyclohexylazetidine;2-methylpropane?
The InChIKey is PMRSKHKCOIGDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C4H10/c1-2-5-9(6-3-1)10-7-4-8-10;1-4(2)3/h9H,1-8H2;4H,1-3H3.
What are the key properties of 1-cyclohexylazetidine;2-methylpropane?
1-cyclohexylazetidine;2-methylpropane has a molecular weight of 197.37 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylazetidine;2-methylpropane is sourced from PubChem (CID 178017193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).