About 1-azabicyclo[3.2.0]heptane;azepane
1-azabicyclo[3.2.0]heptane;azepane (PubChem CID 57473310) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-azabicyclo[3.2.0]heptane;azepane.
Molecular Properties
| Compound Name | 1-azabicyclo[3.2.0]heptane;azepane |
| PubChem CID | 57473310 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-azabicyclo[3.2.0]heptane;azepane |
| SMILES | C1CC2CCN2C1.C1CCCNCC1 |
| InChI | InChI=1S/C6H11N.C6H13N/c1-2-6-3-5-7(6)4-1;1-2-4-6-7-5-3-1/h6H,1-5H2;7H,1-6H2 |
| InChIKey | BCZQDHBJFWRNPU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-azabicyclo[3.2.0]heptane;azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[3.2.0]heptane;azepane?
The IUPAC name of 1-azabicyclo[3.2.0]heptane;azepane (CID 57473310) is 1-azabicyclo[3.2.0]heptane;azepane.
What is the SMILES notation for 1-azabicyclo[3.2.0]heptane;azepane?
The canonical SMILES for 1-azabicyclo[3.2.0]heptane;azepane is C1CC2CCN2C1.C1CCCNCC1.
What is the InChIKey of 1-azabicyclo[3.2.0]heptane;azepane?
The InChIKey is BCZQDHBJFWRNPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.C6H13N/c1-2-6-3-5-7(6)4-1;1-2-4-6-7-5-3-1/h6H,1-5H2;7H,1-6H2.
What are the key properties of 1-azabicyclo[3.2.0]heptane;azepane?
1-azabicyclo[3.2.0]heptane;azepane has a molecular weight of 196.34 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[3.2.0]heptane;azepane is sourced from PubChem (CID 57473310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).