About 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine
1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine (PubChem CID 158755919) has the molecular formula C24H48N4O2
and a molecular weight of 424.67 g/mol. Its IUPAC name is 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine.
Molecular Properties
| Compound Name | 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine |
| PubChem CID | 158755919 |
| Molecular Formula | C24H48N4O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.38 |
| IUPAC Name | 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine |
| SMILES | C1CCN(C2CCOCC2)CC1.C1CCNCC1.C1CN(C2CCOCC2)CCN1 |
| InChI | InChI=1S/C10H19NO.C9H18N2O.C5H11N/c1-2-6-11(7-3-1)10-4-8-12-9-5-10;1-7-12-8-2-9(1)11-5-3-10-4-6-11;1-2-4-6-5-3-1/h10H,1-9H2;9-10H,1-8H2;6H,1-5H2 |
| InChIKey | IOBQMCBFWHWEIS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine?
The IUPAC name of 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine (CID 158755919) is 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine.
What is the SMILES notation for 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine?
The canonical SMILES for 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine is C1CCN(C2CCOCC2)CC1.C1CCNCC1.C1CN(C2CCOCC2)CCN1.
What is the InChIKey of 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine?
The InChIKey is IOBQMCBFWHWEIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.C9H18N2O.C5H11N/c1-2-6-11(7-3-1)10-4-8-12-9-5-10;1-7-12-8-2-9(1)11-5-3-10-4-6-11;1-2-4-6-5-3-1/h10H,1-9H2;9-10H,1-8H2;6H,1-5H2.
What are the key properties of 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine?
1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine has a molecular weight of 424.67 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-yl)piperazine;1-(oxan-4-yl)piperidine;piperidine is sourced from PubChem (CID 158755919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).