C13H24N2O — CID 169161347
2-(oxan-4-yl)-2,8-diazaspiro[4.5]decane (PubChem CID 169161347) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-(oxan-4-yl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-(oxan-4-yl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 169161347 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-(oxan-4-yl)-2,8-diazaspiro[4.5]decane |
| SMILES | C1CC2(CCN1)CCN(C1CCOCC1)C2 |
| InChI | InChI=1S/C13H24N2O/c1-9-16-10-2-12(1)15-8-5-13(11-15)3-6-14-7-4-13/h12,14H,1-11H2 |
| InChIKey | SPJHSZGSSVQTMU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |