C19H35N3 — CID 146248908
3-(3-azaspiro[5.5]undecan-9-yl)-3,9-diazaspiro[5.5]undecane (PubChem CID 146248908) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is 3-(3-azaspiro[5.5]undecan-9-yl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-(3-azaspiro[5.5]undecan-9-yl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 146248908 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | 3-(3-azaspiro[5.5]undecan-9-yl)-3,9-diazaspiro[5.5]undecane |
| SMILES | C1CC2(CCN1)CCC(N1CCC3(CCNCC3)CC1)CC2 |
| InChI | InChI=1S/C19H35N3/c1-3-18(5-11-20-12-6-18)4-2-17(1)22-15-9-19(10-16-22)7-13-21-14-8-19/h17,20-21H,1-16H2 |
| InChIKey | CJNLCZGVRMSCQW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |