About 1-cycloheptylpiperazine;methane
1-cycloheptylpiperazine;methane (PubChem CID 143122535) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-cycloheptylpiperazine;methane.
Molecular Properties
| Compound Name | 1-cycloheptylpiperazine;methane |
| PubChem CID | 143122535 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1-cycloheptylpiperazine;methane |
| SMILES | C.C1CCCC(N2CCNCC2)CC1 |
| InChI | InChI=1S/C11H22N2.CH4/c1-2-4-6-11(5-3-1)13-9-7-12-8-10-13;/h11-12H,1-10H2;1H4 |
| InChIKey | AXRJMGWOFPJMJQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cycloheptylpiperazine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptylpiperazine;methane?
The IUPAC name of 1-cycloheptylpiperazine;methane (CID 143122535) is 1-cycloheptylpiperazine;methane.
What is the SMILES notation for 1-cycloheptylpiperazine;methane?
The canonical SMILES for 1-cycloheptylpiperazine;methane is C.C1CCCC(N2CCNCC2)CC1.
What is the InChIKey of 1-cycloheptylpiperazine;methane?
The InChIKey is AXRJMGWOFPJMJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2.CH4/c1-2-4-6-11(5-3-1)13-9-7-12-8-10-13;/h11-12H,1-10H2;1H4.
What are the key properties of 1-cycloheptylpiperazine;methane?
1-cycloheptylpiperazine;methane has a molecular weight of 198.35 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptylpiperazine;methane is sourced from PubChem (CID 143122535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).