C14H26N2O3 — CID 115315072
1-[4-(1,4-dioxaspiro[4.5]decan-8-yl)morpholin-2-yl]ethanamine (PubChem CID 115315072) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-[4-(1,4-dioxaspiro[4.5]decan-8-yl)morpholin-2-yl]ethanamine.
| Compound Name | 1-[4-(1,4-dioxaspiro[4.5]decan-8-yl)morpholin-2-yl]ethanamine |
|---|---|
| PubChem CID | 115315072 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-[4-(1,4-dioxaspiro[4.5]decan-8-yl)morpholin-2-yl]ethanamine |
| SMILES | CC(N)C1CN(C2CCC3(CC2)OCCO3)CCO1 |
| InChI | InChI=1S/C14H26N2O3/c1-11(15)13-10-16(6-7-17-13)12-2-4-14(5-3-12)18-8-9-19-14/h11-13H,2-10,15H2,1H3 |
| InChIKey | QYQBLRCSGKRMTB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |