C9H18N2O — CID 104932115
(1R)-1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)ethanamine (PubChem CID 104932115) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (1R)-1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)ethanamine.
| Compound Name | (1R)-1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)ethanamine |
|---|---|
| PubChem CID | 104932115 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (1R)-1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)ethanamine |
| SMILES | C[C@@H](N)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C9H18N2O/c1-7(10)9-5-11-4-2-3-8(11)6-12-9/h7-9H,2-6,10H2,1H3/t7-,8?,9?/m1/s1 |
| InChIKey | LPYWDPMQQLZMTE-AFPNSQJFSA-N |
| XLogP | 0.20 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |