C12H23N3O — CID 105245164
[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cyclobutyl)methyl]hydrazine (PubChem CID 105245164) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is [3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cyclobutyl)methyl]hydrazine.
| Compound Name | [3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cyclobutyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105245164 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | [3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cyclobutyl)methyl]hydrazine |
| SMILES | NNC(C1CCC1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C12H23N3O/c13-14-12(9-3-1-4-9)11-7-15-6-2-5-10(15)8-16-11/h9-12,14H,1-8,13H2 |
| InChIKey | DKVNHNYKVWIXCU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|