C10H20N2O — CID 104932294
(1S)-1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)propan-1-amine (PubChem CID 104932294) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is (1S)-1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)propan-1-amine.
| Compound Name | (1S)-1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 104932294 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (1S)-1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)propan-1-amine |
| SMILES | CC[C@H](N)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C10H20N2O/c1-2-9(11)10-6-12-5-3-4-8(12)7-13-10/h8-10H,2-7,11H2,1H3/t8?,9-,10?/m0/s1 |
| InChIKey | WQQDAZMLCVIZEZ-KYHHOPLUSA-N |
| XLogP | 0.59 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |