C17H26N2O — CID 79089404
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2,4,5-trimethylphenyl)methanamine (PubChem CID 79089404) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2,4,5-trimethylphenyl)methanamine.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2,4,5-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 79089404 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2,4,5-trimethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C(N)C2CN3CCCC3CO2)cc1C |
| InChI | InChI=1S/C17H26N2O/c1-11-7-13(3)15(8-12(11)2)17(18)16-9-19-6-4-5-14(19)10-20-16/h7-8,14,16-17H,4-6,9-10,18H2,1-3H3 |
| InChIKey | VFEWGWFFPJLXEK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |