C14H22N4O — CID 79088765
3-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(amino)methyl]-4-methylpyridin-2-amine (PubChem CID 79088765) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(amino)methyl]-4-methylpyridin-2-amine.
| Compound Name | 3-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(amino)methyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 79088765 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 3-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(amino)methyl]-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(N)c1C(N)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H22N4O/c1-9-4-5-17-14(16)12(9)13(15)11-7-18-6-2-3-10(18)8-19-11/h4-5,10-11,13H,2-3,6-8,15H2,1H3,(H2,16,17) |
| InChIKey | LLJWAVDMZHVMMM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |