C15H24N4O — CID 79088315
4-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(methylamino)ethyl]pyridin-2-amine (PubChem CID 79088315) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(methylamino)ethyl]pyridin-2-amine.
| Compound Name | 4-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(methylamino)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 79088315 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(methylamino)ethyl]pyridin-2-amine |
| SMILES | CNC(Cc1ccnc(N)c1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H24N4O/c1-17-13(7-11-4-5-18-15(16)8-11)14-9-19-6-2-3-12(19)10-20-14/h4-5,8,12-14,17H,2-3,6-7,9-10H2,1H3,(H2,16,18) |
| InChIKey | FNGZTWBZIHXKPK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |