C16H22N2O3 — CID 79095648
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine (PubChem CID 79095648) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine |
|---|---|
| PubChem CID | 79095648 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine |
| SMILES | NC(c1ccc2c(c1)OCCO2)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C16H22N2O3/c17-16(15-9-18-5-1-2-12(18)10-21-15)11-3-4-13-14(8-11)20-7-6-19-13/h3-4,8,12,15-16H,1-2,5-7,9-10,17H2 |
| InChIKey | QOGFMADQKIBBRS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |