C17H24N2O — CID 116517715
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-phenylcyclopropyl)methanamine (PubChem CID 116517715) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-phenylcyclopropyl)methanamine.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-phenylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 116517715 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-phenylcyclopropyl)methanamine |
| SMILES | NC(C1CN2CCCC2CO1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C17H24N2O/c18-17(15-9-14(15)12-5-2-1-3-6-12)16-10-19-8-4-7-13(19)11-20-16/h1-3,5-6,13-17H,4,7-11,18H2 |
| InChIKey | SYWXGYYDIBLKNB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |