C17H20N2O2 — CID 79094362
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(quinolin-3-yl)methanol (PubChem CID 79094362) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(quinolin-3-yl)methanol.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(quinolin-3-yl)methanol |
|---|---|
| PubChem CID | 79094362 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(quinolin-3-yl)methanol |
| SMILES | OC(c1cnc2ccccc2c1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C17H20N2O2/c20-17(16-10-19-7-3-5-14(19)11-21-16)13-8-12-4-1-2-6-15(12)18-9-13/h1-2,4,6,8-9,14,16-17,20H,3,5,7,10-11H2 |
| InChIKey | HKGJRXVOJAHAER-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |