C17H25NO3 — CID 104659643
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-propoxyphenyl)methanol (PubChem CID 104659643) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-propoxyphenyl)methanol.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-propoxyphenyl)methanol |
|---|---|
| PubChem CID | 104659643 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-propoxyphenyl)methanol |
| SMILES | CCCOc1ccccc1C(O)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C17H25NO3/c1-2-10-20-15-8-4-3-7-14(15)17(19)16-11-18-9-5-6-13(18)12-21-16/h3-4,7-8,13,16-17,19H,2,5-6,9-12H2,1H3 |
| InChIKey | DFHZKLVJTZHNNY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |