C18H25NO2 — CID 116505824
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-cyclobutylphenyl)methanol (PubChem CID 116505824) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-cyclobutylphenyl)methanol.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-cyclobutylphenyl)methanol |
|---|---|
| PubChem CID | 116505824 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-cyclobutylphenyl)methanol |
| SMILES | OC(c1ccc(C2CCC2)cc1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C18H25NO2/c20-18(17-11-19-10-2-5-16(19)12-21-17)15-8-6-14(7-9-15)13-3-1-4-13/h6-9,13,16-18,20H,1-5,10-12H2 |
| InChIKey | FZNMQZBEOZZEEY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |