C15H20FNO2 — CID 79087688
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-fluoro-2-methylphenyl)methanol (PubChem CID 79087688) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-fluoro-2-methylphenyl)methanol.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-fluoro-2-methylphenyl)methanol |
|---|---|
| PubChem CID | 79087688 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-fluoro-2-methylphenyl)methanol |
| SMILES | Cc1cc(F)ccc1C(O)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H20FNO2/c1-10-7-11(16)4-5-13(10)15(18)14-8-17-6-2-3-12(17)9-19-14/h4-5,7,12,14-15,18H,2-3,6,8-9H2,1H3 |
| InChIKey | IFSHVGCEANUJRO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |