C15H19ClFNO2 — CID 102618123
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(2-chloro-5-fluorophenyl)ethanol (PubChem CID 102618123) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(2-chloro-5-fluorophenyl)ethanol.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(2-chloro-5-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 102618123 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(2-chloro-5-fluorophenyl)ethanol |
| SMILES | OC(Cc1cc(F)ccc1Cl)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H19ClFNO2/c16-13-4-3-11(17)6-10(13)7-14(19)15-8-18-5-1-2-12(18)9-20-15/h3-4,6,12,14-15,19H,1-2,5,7-9H2 |
| InChIKey | DDQIOXMQXWOVGC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |