C17H21NO2S — CID 79094390
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1-benzothiophen-3-yl)ethanol (PubChem CID 79094390) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1-benzothiophen-3-yl)ethanol.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1-benzothiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 79094390 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1-benzothiophen-3-yl)ethanol |
| SMILES | OC(Cc1csc2ccccc12)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C17H21NO2S/c19-15(16-9-18-7-3-4-13(18)10-20-16)8-12-11-21-17-6-2-1-5-14(12)17/h1-2,5-6,11,13,15-16,19H,3-4,7-10H2 |
| InChIKey | OIYBBTIKYLOOMN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |