C16H23N3O — CID 167926790
2,2-dimethyl-5-(4-pyridin-2-ylpiperazin-1-yl)cyclopentan-1-one (PubChem CID 167926790) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 2,2-dimethyl-5-(4-pyridin-2-ylpiperazin-1-yl)cyclopentan-1-one.
| Compound Name | 2,2-dimethyl-5-(4-pyridin-2-ylpiperazin-1-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 167926790 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 2,2-dimethyl-5-(4-pyridin-2-ylpiperazin-1-yl)cyclopentan-1-one |
| SMILES | CC1(C)CCC(N2CCN(c3ccccn3)CC2)C1=O |
| InChI | InChI=1S/C16H23N3O/c1-16(2)7-6-13(15(16)20)18-9-11-19(12-10-18)14-5-3-4-8-17-14/h3-5,8,13H,6-7,9-12H2,1-2H3 |
| InChIKey | CONMZZFFSYSSGT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |