C19H18Cl2N4O2 — CID 1365161
(3S)-1-(3,5-dichlorophenyl)-3-(4-pyridin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione (PubChem CID 1365161) has the molecular formula C19H18Cl2N4O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is (3S)-1-(3,5-dichlorophenyl)-3-(4-pyridin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3,5-dichlorophenyl)-3-(4-pyridin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1365161 |
| Molecular Formula | C19H18Cl2N4O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (3S)-1-(3,5-dichlorophenyl)-3-(4-pyridin-2-ylpiperazin-1-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCN(c3ccccn3)CC2)C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N4O2/c20-13-9-14(21)11-15(10-13)25-18(26)12-16(19(25)27)23-5-7-24(8-6-23)17-3-1-2-4-22-17/h1-4,9-11,16H,5-8,12H2/t16-/m0/s1 |
| InChIKey | FZBKEJPAHWHTTE-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|