C20H28N6 — CID 112898738
N-cycloheptyl-4-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112898738) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is N-cycloheptyl-4-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-cycloheptyl-4-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112898738 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-cycloheptyl-4-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | c1ccc(N2CCN(c3ccnc(NC4CCCCCC4)n3)CC2)nc1 |
| InChI | InChI=1S/C20H28N6/c1-2-4-8-17(7-3-1)23-20-22-12-10-19(24-20)26-15-13-25(14-16-26)18-9-5-6-11-21-18/h5-6,9-12,17H,1-4,7-8,13-16H2,(H,22,23,24) |
| InChIKey | ITFVHYGYIYFEHH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |