C23H39N5 — CID 66904387
N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-cycloheptylazepan-3-amine (PubChem CID 66904387) has the molecular formula C23H39N5 and a molecular weight of 385.60 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-cycloheptylazepan-3-amine.
| Compound Name | N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-cycloheptylazepan-3-amine |
|---|---|
| PubChem CID | 66904387 |
| Molecular Formula | C23H39N5 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-cycloheptylazepan-3-amine |
| SMILES | c1cc(N2CCCCCC2)nc(NC2CCCCN(C3CCCCCC3)C2)n1 |
| InChI | InChI=1S/C23H39N5/c1-2-6-13-21(12-5-1)28-18-10-7-11-20(19-28)25-23-24-15-14-22(26-23)27-16-8-3-4-9-17-27/h14-15,20-21H,1-13,16-19H2,(H,24,25,26) |
| InChIKey | GHWCODFBBZCLJJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |