C21H36N6 — CID 66904457
N-[1-(4-aminocyclohexyl)piperidin-3-yl]-4-(azepan-1-yl)pyrimidin-2-amine (PubChem CID 66904457) has the molecular formula C21H36N6 and a molecular weight of 372.56 g/mol. Its IUPAC name is N-[1-(4-aminocyclohexyl)piperidin-3-yl]-4-(azepan-1-yl)pyrimidin-2-amine.
| Compound Name | N-[1-(4-aminocyclohexyl)piperidin-3-yl]-4-(azepan-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66904457 |
| Molecular Formula | C21H36N6 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | N-[1-(4-aminocyclohexyl)piperidin-3-yl]-4-(azepan-1-yl)pyrimidin-2-amine |
| SMILES | NC1CCC(N2CCCC(Nc3nccc(N4CCCCCC4)n3)C2)CC1 |
| InChI | InChI=1S/C21H36N6/c22-17-7-9-19(10-8-17)27-15-5-6-18(16-27)24-21-23-12-11-20(25-21)26-13-3-1-2-4-14-26/h11-12,17-19H,1-10,13-16,22H2,(H,23,24,25) |
| InChIKey | BVATZTFLWJLAIW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |