C19H31N5S — CID 66904297
4-(azepan-1-yl)-N-[1-(thiolan-3-yl)piperidin-3-yl]pyrimidin-2-amine (PubChem CID 66904297) has the molecular formula C19H31N5S and a molecular weight of 361.56 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-[1-(thiolan-3-yl)piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-[1-(thiolan-3-yl)piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 66904297 |
| Molecular Formula | C19H31N5S |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 4-(azepan-1-yl)-N-[1-(thiolan-3-yl)piperidin-3-yl]pyrimidin-2-amine |
| SMILES | c1cc(N2CCCCCC2)nc(NC2CCCN(C3CCSC3)C2)n1 |
| InChI | InChI=1S/C19H31N5S/c1-2-4-11-23(10-3-1)18-7-9-20-19(22-18)21-16-6-5-12-24(14-16)17-8-13-25-15-17/h7,9,16-17H,1-6,8,10-15H2,(H,20,21,22) |
| InChIKey | OILAPRNWMYNCPX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |