C21H35N5 — CID 66903248
N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-cyclopentylazepan-3-amine (PubChem CID 66903248) has the molecular formula C21H35N5 and a molecular weight of 357.55 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-cyclopentylazepan-3-amine.
| Compound Name | N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-cyclopentylazepan-3-amine |
|---|---|
| PubChem CID | 66903248 |
| Molecular Formula | C21H35N5 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-cyclopentylazepan-3-amine |
| SMILES | c1cc(N2CCCCCC2)nc(NC2CCCCN(C3CCCC3)C2)n1 |
| InChI | InChI=1S/C21H35N5/c1-2-7-15-25(14-6-1)20-12-13-22-21(24-20)23-18-9-5-8-16-26(17-18)19-10-3-4-11-19/h12-13,18-19H,1-11,14-17H2,(H,22,23,24) |
| InChIKey | RGYBHVBOOVSUGA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |