C22H37N5 — CID 66904117
4-(azepan-1-yl)-N-(1-cyclooctylpyrrolidin-3-yl)pyrimidin-2-amine (PubChem CID 66904117) has the molecular formula C22H37N5 and a molecular weight of 371.57 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-(1-cyclooctylpyrrolidin-3-yl)pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-(1-cyclooctylpyrrolidin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66904117 |
| Molecular Formula | C22H37N5 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | 4-(azepan-1-yl)-N-(1-cyclooctylpyrrolidin-3-yl)pyrimidin-2-amine |
| SMILES | c1cc(N2CCCCCC2)nc(NC2CCN(C3CCCCCCC3)C2)n1 |
| InChI | InChI=1S/C22H37N5/c1-2-6-10-20(11-7-3-1)27-17-13-19(18-27)24-22-23-14-12-21(25-22)26-15-8-4-5-9-16-26/h12,14,19-20H,1-11,13,15-18H2,(H,23,24,25) |
| InChIKey | ULQNPYBCBLXZBF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |