C26H38N6O2S — CID 66903312
4-(azepan-1-yl)-N-[1-[1-(benzenesulfonyl)piperidin-3-yl]piperidin-3-yl]pyrimidin-2-amine (PubChem CID 66903312) has the molecular formula C26H38N6O2S and a molecular weight of 498.70 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-[1-[1-(benzenesulfonyl)piperidin-3-yl]piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-[1-[1-(benzenesulfonyl)piperidin-3-yl]piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 66903312 |
| Molecular Formula | C26H38N6O2S |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 4-(azepan-1-yl)-N-[1-[1-(benzenesulfonyl)piperidin-3-yl]piperidin-3-yl]pyrimidin-2-amine |
| SMILES | O=S(=O)(c1ccccc1)N1CCCC(N2CCCC(Nc3nccc(N4CCCCCC4)n3)C2)C1 |
| InChI | InChI=1S/C26H38N6O2S/c33-35(34,24-12-4-3-5-13-24)32-19-9-11-23(21-32)31-18-8-10-22(20-31)28-26-27-15-14-25(29-26)30-16-6-1-2-7-17-30/h3-5,12-15,22-23H,1-2,6-11,16-21H2,(H,27,28,29) |
| InChIKey | PERAVMZUKCWIOF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |