C29H42N6O — CID 66904456
1-[3-[3-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]azepan-1-yl]piperidin-1-yl]-2-phenylethanone (PubChem CID 66904456) has the molecular formula C29H42N6O and a molecular weight of 490.70 g/mol. Its IUPAC name is 1-[3-[3-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]azepan-1-yl]piperidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[3-[3-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]azepan-1-yl]piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 66904456 |
| Molecular Formula | C29H42N6O |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.34 |
| IUPAC Name | 1-[3-[3-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]azepan-1-yl]piperidin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCCC(N2CCCCC(Nc3nccc(N4CCCCCC4)n3)C2)C1 |
| InChI | InChI=1S/C29H42N6O/c36-28(21-24-11-4-3-5-12-24)35-20-10-14-26(23-35)34-19-9-6-13-25(22-34)31-29-30-16-15-27(32-29)33-17-7-1-2-8-18-33/h3-5,11-12,15-16,25-26H,1-2,6-10,13-14,17-23H2,(H,30,31,32) |
| InChIKey | WIHVVKQISPSZCC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |