C25H35N7O4S — CID 66904483
4-(azepan-1-yl)-N-[1-[1-(4-nitrophenyl)sulfonylpiperidin-3-yl]pyrrolidin-3-yl]pyrimidin-2-amine (PubChem CID 66904483) has the molecular formula C25H35N7O4S and a molecular weight of 529.67 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-[1-[1-(4-nitrophenyl)sulfonylpiperidin-3-yl]pyrrolidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-[1-[1-(4-nitrophenyl)sulfonylpiperidin-3-yl]pyrrolidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 66904483 |
| Molecular Formula | C25H35N7O4S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 4-(azepan-1-yl)-N-[1-[1-(4-nitrophenyl)sulfonylpiperidin-3-yl]pyrrolidin-3-yl]pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCCC(N3CCC(Nc4nccc(N5CCCCCC5)n4)C3)C2)cc1 |
| InChI | InChI=1S/C25H35N7O4S/c33-32(34)21-7-9-23(10-8-21)37(35,36)31-16-5-6-22(19-31)30-17-12-20(18-30)27-25-26-13-11-24(28-25)29-14-3-1-2-4-15-29/h7-11,13,20,22H,1-6,12,14-19H2,(H,26,27,28) |
| InChIKey | YWQPAZHWVHPCBA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|