C19H20N6 — CID 112898748
N-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112898748) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is N-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112898748 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-phenyl-4-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | c1ccc(Nc2nccc(N3CCN(c4ccccn4)CC3)n2)cc1 |
| InChI | InChI=1S/C19H20N6/c1-2-6-16(7-3-1)22-19-21-11-9-18(23-19)25-14-12-24(13-15-25)17-8-4-5-10-20-17/h1-11H,12-15H2,(H,21,22,23) |
| InChIKey | DQRLAQOXURVJSR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |