C19H19N5O — CID 71458570
4-(2-morpholin-4-yl-4-pyridinyl)-N-phenylpyrimidin-2-amine (PubChem CID 71458570) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 4-(2-morpholin-4-yl-4-pyridinyl)-N-phenylpyrimidin-2-amine.
| Compound Name | 4-(2-morpholin-4-yl-4-pyridinyl)-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 71458570 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-(2-morpholin-4-yl-4-pyridinyl)-N-phenylpyrimidin-2-amine |
| SMILES | c1ccc(Nc2nccc(-c3ccnc(N4CCOCC4)c3)n2)cc1 |
| InChI | InChI=1S/C19H19N5O/c1-2-4-16(5-3-1)22-19-21-9-7-17(23-19)15-6-8-20-18(14-15)24-10-12-25-13-11-24/h1-9,14H,10-13H2,(H,21,22,23) |
| InChIKey | DTSPPRSFKBTQDO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |