C21H30N6 — CID 112923831
N-cycloheptyl-4-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112923831) has the molecular formula C21H30N6 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-cycloheptyl-4-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-cycloheptyl-4-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112923831 |
| Molecular Formula | C21H30N6 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | N-cycloheptyl-4-methyl-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCN(c3ccccn3)CC2)nc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C21H30N6/c1-17-16-20(25-21(23-17)24-18-8-4-2-3-5-9-18)27-14-12-26(13-15-27)19-10-6-7-11-22-19/h6-7,10-11,16,18H,2-5,8-9,12-15H2,1H3,(H,23,24,25) |
| InChIKey | IJCCRBLINNZMKO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |